About 1-methyl-2-benzoborinine
1-methyl-2-benzoborinine (PubChem CID 143292275) has the molecular formula C10H9B
and a molecular weight of 139.99 g/mol. Its IUPAC name is 1-methyl-2-benzoborinine.
Molecular Properties
| Compound Name | 1-methyl-2-benzoborinine |
| PubChem CID | 143292275 |
| Molecular Formula | C10H9B |
| Molecular Weight | 139.99 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 1-methyl-2-benzoborinine |
| SMILES | Cc1bccc2ccccc12 |
| InChI | InChI=1S/C10H9B/c1-8-10-5-3-2-4-9(10)6-7-11-8/h2-7H,1H3 |
| InChIKey | WZAVWPREDKPYTJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.99 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-2-benzoborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-benzoborinine?
The IUPAC name of 1-methyl-2-benzoborinine (CID 143292275) is 1-methyl-2-benzoborinine.
What is the SMILES notation for 1-methyl-2-benzoborinine?
The canonical SMILES for 1-methyl-2-benzoborinine is Cc1bccc2ccccc12.
What is the InChIKey of 1-methyl-2-benzoborinine?
The InChIKey is WZAVWPREDKPYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9B/c1-8-10-5-3-2-4-9(10)6-7-11-8/h2-7H,1H3.
What are the key properties of 1-methyl-2-benzoborinine?
1-methyl-2-benzoborinine has a molecular weight of 139.99 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-benzoborinine is sourced from PubChem (CID 143292275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).