C22H12O4S — CID 123261272
12-thiapentacyclo[11.10.0.02,11.04,9.015,22]tricosa-1(13),2(11),4,6,8,15(22),18,20-octaene-3,10,14,23-tetrone (PubChem CID 123261272) has the molecular formula C22H12O4S and a molecular weight of 372.40 g/mol. Its IUPAC name is 12-thiapentacyclo[11.10.0.02,11.04,9.015,22]tricosa-1(13),2(11),4,6,8,15(22),18,20-octaene-3,10,14,23-tetrone.
| Compound Name | 12-thiapentacyclo[11.10.0.02,11.04,9.015,22]tricosa-1(13),2(11),4,6,8,15(22),18,20-octaene-3,10,14,23-tetrone |
|---|---|
| PubChem CID | 123261272 |
| Molecular Formula | C22H12O4S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 12-thiapentacyclo[11.10.0.02,11.04,9.015,22]tricosa-1(13),2(11),4,6,8,15(22),18,20-octaene-3,10,14,23-tetrone |
| SMILES | O=c1c2c(c(=O)c3c1sc1c(=O)c4ccccc4c(=O)c13)C=CC=CCC2 |
| InChI | InChI=1S/C22H12O4S/c23-17-11-7-3-1-2-4-8-13(11)19(25)21-15(17)16-18(24)12-9-5-6-10-14(12)20(26)22(16)27-21/h1-3,5-7,9-10H,4,8H2 |
| InChIKey | WTLIHMDCYZMXJR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|