About benzo[7]annulene;propane
benzo[7]annulene;propane (PubChem CID 143124773) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is benzo[7]annulene;propane.
Molecular Properties
| Compound Name | benzo[7]annulene;propane |
| PubChem CID | 143124773 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | benzo[7]annulene;propane |
| SMILES | C1=CC=Cc2ccccc2C=1.CCC |
| InChI | InChI=1S/C11H8.C3H8/c1-2-6-10-8-4-5-9-11(10)7-3-1;1-3-2/h1-2,4-9H;3H2,1-2H3 |
| InChIKey | CVBLHZRWAMXEKE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzo[7]annulene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[7]annulene;propane?
The IUPAC name of benzo[7]annulene;propane (CID 143124773) is benzo[7]annulene;propane.
What is the SMILES notation for benzo[7]annulene;propane?
The canonical SMILES for benzo[7]annulene;propane is C1=CC=Cc2ccccc2C=1.CCC.
What is the InChIKey of benzo[7]annulene;propane?
The InChIKey is CVBLHZRWAMXEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8.C3H8/c1-2-6-10-8-4-5-9-11(10)7-3-1;1-3-2/h1-2,4-9H;3H2,1-2H3.
What are the key properties of benzo[7]annulene;propane?
benzo[7]annulene;propane has a molecular weight of 184.28 g/mol, XLogP of 4.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[7]annulene;propane is sourced from PubChem (CID 143124773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).