About 7-methylbenzo[7]annulene
7-methylbenzo[7]annulene (PubChem CID 142045032) has the molecular formula C12H10
and a molecular weight of 154.21 g/mol. Its IUPAC name is 7-methylbenzo[7]annulene.
Molecular Properties
| Compound Name | 7-methylbenzo[7]annulene |
| PubChem CID | 142045032 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 7-methylbenzo[7]annulene |
| SMILES | CC1=C=Cc2ccccc2C=C1 |
| InChI | InChI=1S/C12H10/c1-10-6-8-11-4-2-3-5-12(11)9-7-10/h2-6,8-9H,1H3 |
| InChIKey | CKOLJNXBMRDMGT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-methylbenzo[7]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylbenzo[7]annulene?
The IUPAC name of 7-methylbenzo[7]annulene (CID 142045032) is 7-methylbenzo[7]annulene.
What is the SMILES notation for 7-methylbenzo[7]annulene?
The canonical SMILES for 7-methylbenzo[7]annulene is CC1=C=Cc2ccccc2C=C1.
What is the InChIKey of 7-methylbenzo[7]annulene?
The InChIKey is CKOLJNXBMRDMGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10/c1-10-6-8-11-4-2-3-5-12(11)9-7-10/h2-6,8-9H,1H3.
What are the key properties of 7-methylbenzo[7]annulene?
7-methylbenzo[7]annulene has a molecular weight of 154.21 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylbenzo[7]annulene is sourced from PubChem (CID 142045032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).