C17H11NO2 — CID 143309594
2-[(7Z)-6-methylcycloocta-1,2,4,5,7-pentaen-1-yl]isoindole-1,3-dione (PubChem CID 143309594) has the molecular formula C17H11NO2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[(7Z)-6-methylcycloocta-1,2,4,5,7-pentaen-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(7Z)-6-methylcycloocta-1,2,4,5,7-pentaen-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143309594 |
| Molecular Formula | C17H11NO2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-[(7Z)-6-methylcycloocta-1,2,4,5,7-pentaen-1-yl]isoindole-1,3-dione |
| SMILES | CC1=C=CC=C=C(N2C(=O)c3ccccc3C2=O)/C=C\1 |
| InChI | InChI=1S/C17H11NO2/c1-12-6-2-3-7-13(11-10-12)18-16(19)14-8-4-5-9-15(14)17(18)20/h2-5,8-11H,1H3/b11-10- |
| InChIKey | KRRBMQUYZPRPNG-KHPPLWFESA-N |
| XLogP | 2.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|