C15H10 — CID 123541076
tricyclo[9.4.0.03,8]pentadeca-1(15),2,4,6,8,9,11,13-octaene (PubChem CID 123541076) has the molecular formula C15H10 and a molecular weight of 190.24 g/mol. Its IUPAC name is tricyclo[9.4.0.03,8]pentadeca-1(15),2,4,6,8,9,11,13-octaene.
| Compound Name | tricyclo[9.4.0.03,8]pentadeca-1(15),2,4,6,8,9,11,13-octaene |
|---|---|
| PubChem CID | 123541076 |
| Molecular Formula | C15H10 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | tricyclo[9.4.0.03,8]pentadeca-1(15),2,4,6,8,9,11,13-octaene |
| SMILES | C1=Cc2ccccc2C=c2ccccc2=1 |
| InChI | InChI=1S/C15H10/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1/h1-9,11H |
| InChIKey | RGIXESJWHLEUCK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |