About benzo[8]annulene
benzo[8]annulene (PubChem CID 173075501) has the molecular formula C12H8
and a molecular weight of 152.20 g/mol. Its IUPAC name is benzo[8]annulene.
Molecular Properties
| Compound Name | benzo[8]annulene |
| PubChem CID | 173075501 |
| Molecular Formula | C12H8 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | benzo[8]annulene |
| SMILES | C1=C=Cc2ccccc2C=CC=1 |
| InChI | InChI=1S/C12H8/c1-2-4-8-12-10-6-5-9-11(12)7-3-1/h1,3,5-10H/b3-1?,7-3?,11-7?,12-8- |
| InChIKey | UAZJWWJVWJNVTR-RVUJDMGOSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzo[8]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[8]annulene?
The IUPAC name of benzo[8]annulene (CID 173075501) is benzo[8]annulene.
What is the SMILES notation for benzo[8]annulene?
The canonical SMILES for benzo[8]annulene is C1=C=Cc2ccccc2C=CC=1.
What is the InChIKey of benzo[8]annulene?
The InChIKey is UAZJWWJVWJNVTR-RVUJDMGOSA-N. The full InChI is InChI=1S/C12H8/c1-2-4-8-12-10-6-5-9-11(12)7-3-1/h1,3,5-10H/b3-1?,7-3?,11-7?,12-8-.
What are the key properties of benzo[8]annulene?
benzo[8]annulene has a molecular weight of 152.20 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[8]annulene is sourced from PubChem (CID 173075501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).