C16H10 — CID 4904586
indeno[1,2-a]indene (PubChem CID 4904586) has the molecular formula C16H10 and a molecular weight of 202.26 g/mol. Its IUPAC name is indeno[1,2-a]indene.
| Compound Name | indeno[1,2-a]indene |
|---|---|
| PubChem CID | 4904586 |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | indeno[1,2-a]indene |
| SMILES | C1=C2C=c3ccccc3=C2c2ccccc21 |
| InChI | InChI=1S/C16H10/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15(12)16(13)14/h1-10H |
| InChIKey | XOERMEAUYMRNNZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |