About 9H-fluorene;fluoren-2-one
9H-fluorene;fluoren-2-one (PubChem CID 161252645) has the molecular formula C26H18O
and a molecular weight of 346.43 g/mol. Its IUPAC name is 9H-fluorene;fluoren-2-one.
Molecular Properties
| Compound Name | 9H-fluorene;fluoren-2-one |
| PubChem CID | 161252645 |
| Molecular Formula | C26H18O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 9H-fluorene;fluoren-2-one |
| SMILES | O=C1C=CC2=c3ccccc3=CC2=C1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H8O.C13H10/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H;1-8H,9H2 |
| InChIKey | VBLYVAUWLSLOAS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-fluorene;fluoren-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;fluoren-2-one?
The IUPAC name of 9H-fluorene;fluoren-2-one (CID 161252645) is 9H-fluorene;fluoren-2-one.
What is the SMILES notation for 9H-fluorene;fluoren-2-one?
The canonical SMILES for 9H-fluorene;fluoren-2-one is O=C1C=CC2=c3ccccc3=CC2=C1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;fluoren-2-one?
The InChIKey is VBLYVAUWLSLOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O.C13H10/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H;1-8H,9H2.
What are the key properties of 9H-fluorene;fluoren-2-one?
9H-fluorene;fluoren-2-one has a molecular weight of 346.43 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;fluoren-2-one is sourced from PubChem (CID 161252645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).