C30H20Cl4 — CID 101012760
6,7-bis(dichloromethyl)-8,12-diphenylbenzo[a]heptalene (PubChem CID 101012760) has the molecular formula C30H20Cl4 and a molecular weight of 522.30 g/mol. Its IUPAC name is 6,7-bis(dichloromethyl)-8,12-diphenylbenzo[a]heptalene.
| Compound Name | 6,7-bis(dichloromethyl)-8,12-diphenylbenzo[a]heptalene |
|---|---|
| PubChem CID | 101012760 |
| Molecular Formula | C30H20Cl4 |
| Molecular Weight | 522.30 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 6,7-bis(dichloromethyl)-8,12-diphenylbenzo[a]heptalene |
| SMILES | ClC(Cl)C1=C(C(Cl)Cl)C2=C(c3ccccc3)C=CC=C(c3ccccc3)C2=c2ccccc2=C1 |
| InChI | InChI=1S/C30H20Cl4/c31-29(32)25-18-21-14-7-8-15-24(21)26-22(19-10-3-1-4-11-19)16-9-17-23(20-12-5-2-6-13-20)27(26)28(25)30(33)34/h1-18,29-30H |
| InChIKey | NQHKVWXQTMUNAI-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.30 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|