C27H18 — CID 14023518
7,9-diphenyl-9cH-cyclopenta[a]acenaphthylene (PubChem CID 14023518) has the molecular formula C27H18 and a molecular weight of 342.44 g/mol. Its IUPAC name is 7,9-diphenyl-9cH-cyclopenta[a]acenaphthylene.
| Compound Name | 7,9-diphenyl-9cH-cyclopenta[a]acenaphthylene |
|---|---|
| PubChem CID | 14023518 |
| Molecular Formula | C27H18 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 7,9-diphenyl-9cH-cyclopenta[a]acenaphthylene |
| SMILES | C1=CC2=CC=CC3=C4C(c5ccccc5)=CC(c5ccccc5)=C4C(=C1)C23 |
| InChI | InChI=1S/C27H18/c1-3-9-18(10-4-1)23-17-24(19-11-5-2-6-12-19)27-22-16-8-14-20-13-7-15-21(25(20)22)26(23)27/h1-17,25H |
| InChIKey | HXARJECOUCLIMU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |