About 2-phenyl-9bH-phenalene
2-phenyl-9bH-phenalene (PubChem CID 58645169) has the molecular formula C19H14
and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-phenyl-9bH-phenalene.
Molecular Properties
| Compound Name | 2-phenyl-9bH-phenalene |
| PubChem CID | 58645169 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-phenyl-9bH-phenalene |
| SMILES | C1=CC2=CC=CC3=CC(c4ccccc4)=CC(=C1)[C@H]23 |
| InChI | InChI=1S/C19H14/c1-2-6-14(7-3-1)18-12-16-10-4-8-15-9-5-11-17(13-18)19(15)16/h1-13,19H |
| InChIKey | NILYWNDPNGVDMW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-phenyl-9bH-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-9bH-phenalene?
The IUPAC name of 2-phenyl-9bH-phenalene (CID 58645169) is 2-phenyl-9bH-phenalene.
What is the SMILES notation for 2-phenyl-9bH-phenalene?
The canonical SMILES for 2-phenyl-9bH-phenalene is C1=CC2=CC=CC3=CC(c4ccccc4)=CC(=C1)[C@H]23.
What is the InChIKey of 2-phenyl-9bH-phenalene?
The InChIKey is NILYWNDPNGVDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14/c1-2-6-14(7-3-1)18-12-16-10-4-8-15-9-5-11-17(13-18)19(15)16/h1-13,19H.
What are the key properties of 2-phenyl-9bH-phenalene?
2-phenyl-9bH-phenalene has a molecular weight of 242.32 g/mol, XLogP of 4.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-9bH-phenalene is sourced from PubChem (CID 58645169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).