About 2,6-diphenylarsinine
2,6-diphenylarsinine (PubChem CID 86235300) has the molecular formula C17H13As
and a molecular weight of 292.21 g/mol. Its IUPAC name is 2,6-diphenylarsinine.
Molecular Properties
| Compound Name | 2,6-diphenylarsinine |
| PubChem CID | 86235300 |
| Molecular Formula | C17H13As |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2,6-diphenylarsinine |
| SMILES | C1=CC(c2ccccc2)=[As]C(c2ccccc2)=C1 |
| InChI | InChI=1S/C17H13As/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15/h1-13H |
| InChIKey | XVBBFBFSNYNMEQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diphenylarsinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diphenylarsinine?
The IUPAC name of 2,6-diphenylarsinine (CID 86235300) is 2,6-diphenylarsinine.
What is the SMILES notation for 2,6-diphenylarsinine?
The canonical SMILES for 2,6-diphenylarsinine is C1=CC(c2ccccc2)=[As]C(c2ccccc2)=C1.
What is the InChIKey of 2,6-diphenylarsinine?
The InChIKey is XVBBFBFSNYNMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13As/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15/h1-13H.
What are the key properties of 2,6-diphenylarsinine?
2,6-diphenylarsinine has a molecular weight of 292.21 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diphenylarsinine is sourced from PubChem (CID 86235300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).