C27H24N2 — CID 162283619
1-N,9-N-dimethyl-1-N,9-N-diphenyl-9bH-phenalene-1,9-diamine (PubChem CID 162283619) has the molecular formula C27H24N2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-N,9-N-dimethyl-1-N,9-N-diphenyl-9bH-phenalene-1,9-diamine.
| Compound Name | 1-N,9-N-dimethyl-1-N,9-N-diphenyl-9bH-phenalene-1,9-diamine |
|---|---|
| PubChem CID | 162283619 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-N,9-N-dimethyl-1-N,9-N-diphenyl-9bH-phenalene-1,9-diamine |
| SMILES | CN(C1=CC=C2C=CC=C3C=CC(N(C)c4ccccc4)=C1C32)c1ccccc1 |
| InChI | InChI=1S/C27H24N2/c1-28(22-12-5-3-6-13-22)24-18-16-20-10-9-11-21-17-19-25(27(24)26(20)21)29(2)23-14-7-4-8-15-23/h3-19,26H,1-2H3 |
| InChIKey | KKJAYMKYYUMKCR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |