C16H17S- — CID 162398099
(1Z)-2,2-dimethyl-1-(2-phenylcyclopenta-2,4-dien-1-ylidene)propane-1-thiolate (PubChem CID 162398099) has the molecular formula C16H17S- and a molecular weight of 241.38 g/mol. Its IUPAC name is (1Z)-2,2-dimethyl-1-(2-phenylcyclopenta-2,4-dien-1-ylidene)propane-1-thiolate.
| Compound Name | (1Z)-2,2-dimethyl-1-(2-phenylcyclopenta-2,4-dien-1-ylidene)propane-1-thiolate |
|---|---|
| PubChem CID | 162398099 |
| Molecular Formula | C16H17S- |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (1Z)-2,2-dimethyl-1-(2-phenylcyclopenta-2,4-dien-1-ylidene)propane-1-thiolate |
| SMILES | CC(C)(C)/C([S-])=C1\C=CC=C1c1ccccc1 |
| InChI | InChI=1S/C16H18S/c1-16(2,3)15(17)14-11-7-10-13(14)12-8-5-4-6-9-12/h4-11,17H,1-3H3/p-1/b15-14- |
| InChIKey | YGFYWCVZORSHHS-PFONDFGASA-M |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|