C26H24 — CID 5378956
(1Z)-1-(2,2-dimethyl-1-phenylpropylidene)-3-phenylindene (PubChem CID 5378956) has the molecular formula C26H24 and a molecular weight of 336.48 g/mol. Its IUPAC name is (1Z)-1-(2,2-dimethyl-1-phenylpropylidene)-3-phenylindene.
| Compound Name | (1Z)-1-(2,2-dimethyl-1-phenylpropylidene)-3-phenylindene |
|---|---|
| PubChem CID | 5378956 |
| Molecular Formula | C26H24 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (1Z)-1-(2,2-dimethyl-1-phenylpropylidene)-3-phenylindene |
| SMILES | CC(C)(C)/C(=C1\C=C(c2ccccc2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C26H24/c1-26(2,3)25(20-14-8-5-9-15-20)24-18-23(19-12-6-4-7-13-19)21-16-10-11-17-22(21)24/h4-18H,1-3H3/b25-24+ |
| InChIKey | JELINYJEQHJLNJ-OCOZRVBESA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|