C19H17OP — CID 134941801
(1E)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-ylidene)ethanol (PubChem CID 134941801) has the molecular formula C19H17OP and a molecular weight of 292.32 g/mol. Its IUPAC name is (1E)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-ylidene)ethanol.
| Compound Name | (1E)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-ylidene)ethanol |
|---|---|
| PubChem CID | 134941801 |
| Molecular Formula | C19H17OP |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (1E)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-ylidene)ethanol |
| SMILES | C/C(O)=C1/C=CC=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17OP/c1-15(20)18-13-8-14-19(18)21(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-14,20H,1H3/b18-15+ |
| InChIKey | RVOYVAOGHCQWQI-OBGWFSINSA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|