About (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene
(2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene (PubChem CID 59575046) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene.
Analyze (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene?
The IUPAC name of (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene (CID 59575046) is (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene.
What is the SMILES notation for (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene?
The canonical SMILES for (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene is C1=C\C2=C(/C=C\C3=C/1CC3)CC2.
What is the InChIKey of (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene?
The InChIKey is YQTKKNGNANZQRA-BUPHUOCMSA-N. The full InChI is InChI=1S/C12H12/c1-2-10-7-8-12-4-3-11(12)6-5-9(1)10/h5-8H,1-4H2/b6-5-,8-7-,9-5-,10-7-,11-6-,12-8-.
What are the key properties of (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene?
(2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene has a molecular weight of 156.23 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,8Z)-tricyclo[8.2.0.04,7]dodeca-1(10),2,4(7),8-tetraene is sourced from PubChem (CID 59575046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).