About 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride
3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride (PubChem CID 144971731) has the molecular formula C11H15F
and a molecular weight of 166.24 g/mol. Its IUPAC name is 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride.
Analyze 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride?
The IUPAC name of 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride (CID 144971731) is 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride.
What is the SMILES notation for 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride?
The canonical SMILES for 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride is CC1=CC2=C(C=CCC2)CC1.F.
What is the InChIKey of 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride?
The InChIKey is JWFPEGUNOUWMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14.FH/c1-9-6-7-10-4-2-3-5-11(10)8-9;/h2,4,8H,3,5-7H2,1H3;1H.
What are the key properties of 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride?
3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride has a molecular weight of 166.24 g/mol, XLogP of 3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2,5,6-tetrahydronaphthalene;hydrofluoride is sourced from PubChem (CID 144971731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).