C9H11N — CID 173071851
1,2,5,6-tetrahydroisoquinoline (PubChem CID 173071851) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 1,2,5,6-tetrahydroisoquinoline.
| Compound Name | 1,2,5,6-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 173071851 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 1,2,5,6-tetrahydroisoquinoline |
| SMILES | C1=CC2=C(C=CNC2)CC1 |
| InChI | InChI=1S/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h2,4-6,10H,1,3,7H2 |
| InChIKey | CXOUAQNGTZSUNA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |