C8H10N2 — CID 173071639
1,2,7,8-tetrahydrocinnoline (PubChem CID 173071639) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 1,2,7,8-tetrahydrocinnoline.
| Compound Name | 1,2,7,8-tetrahydrocinnoline |
|---|---|
| PubChem CID | 173071639 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 1,2,7,8-tetrahydrocinnoline |
| SMILES | C1=CC2=C(CC1)NNC=C2 |
| InChI | InChI=1S/C8H10N2/c1-2-4-8-7(3-1)5-6-9-10-8/h1,3,5-6,9-10H,2,4H2 |
| InChIKey | PLBCRZMYOAOPGZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |