C8H9NO3 — CID 163929995
4-hydroxy-3,4,5,6-tetrahydro-1,3-benzoxazin-2-one (PubChem CID 163929995) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 4-hydroxy-3,4,5,6-tetrahydro-1,3-benzoxazin-2-one.
| Compound Name | 4-hydroxy-3,4,5,6-tetrahydro-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 163929995 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 4-hydroxy-3,4,5,6-tetrahydro-1,3-benzoxazin-2-one |
| SMILES | O=C1NC(O)C2=C(C=CCC2)O1 |
| InChI | InChI=1S/C8H9NO3/c10-7-5-3-1-2-4-6(5)12-8(11)9-7/h2,4,7,10H,1,3H2,(H,9,11) |
| InChIKey | RHWDJVRLRATVFD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |