C17H13NO4S — CID 88708608
3-(10-hydroxy-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepin-6-yl)pyrrole-2,5-dione (PubChem CID 88708608) has the molecular formula C17H13NO4S and a molecular weight of 327.36 g/mol. Its IUPAC name is 3-(10-hydroxy-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepin-6-yl)pyrrole-2,5-dione.
| Compound Name | 3-(10-hydroxy-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepin-6-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 88708608 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 3-(10-hydroxy-2,10a-dihydro-1H-benzo[c][1,5]benzoxathiepin-6-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(C2=C3C=CC=C(O)C3SC3=C(C=CCC3)O2)C(=O)N1 |
| InChI | InChI=1S/C17H13NO4S/c19-11-5-3-4-9-15(10-8-14(20)18-17(10)21)22-12-6-1-2-7-13(12)23-16(9)11/h1,3-6,8,16,19H,2,7H2,(H,18,20,21) |
| InChIKey | FMNAVUWFWVGLAP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|