C8H6N2O5 — CID 151968120
3-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)pyrrole-2,5-dione (PubChem CID 151968120) has the molecular formula C8H6N2O5 and a molecular weight of 210.14 g/mol. Its IUPAC name is 3-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 151968120 |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 3-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(N2C(=O)CC(O)C2=O)C(=O)N1 |
| InChI | InChI=1S/C8H6N2O5/c11-4-2-6(13)10(8(4)15)3-1-5(12)9-7(3)14/h1,4,11H,2H2,(H,9,12,14) |
| InChIKey | UACFZFBJPDHIFC-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|