C6H7N3O3 — CID 73183367
4-amino-2,6-dioxo-3H-pyridine-3-carboxamide (PubChem CID 73183367) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 4-amino-2,6-dioxo-3H-pyridine-3-carboxamide.
| Compound Name | 4-amino-2,6-dioxo-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 73183367 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 4-amino-2,6-dioxo-3H-pyridine-3-carboxamide |
| SMILES | NC(=O)C1C(=O)NC(=O)C=C1N |
| InChI | InChI=1S/C6H7N3O3/c7-2-1-3(10)9-6(12)4(2)5(8)11/h1,4H,7H2,(H2,8,11)(H,9,10,12) |
| InChIKey | XIAJTLRGGWKZGJ-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|