About 3-benzoylpyrrole-2,5-dione
3-benzoylpyrrole-2,5-dione (PubChem CID 154096189) has the molecular formula C11H7NO3
and a molecular weight of 201.18 g/mol. Its IUPAC name is 3-benzoylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-benzoylpyrrole-2,5-dione |
| PubChem CID | 154096189 |
| Molecular Formula | C11H7NO3 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 3-benzoylpyrrole-2,5-dione |
| SMILES | O=C1C=C(C(=O)c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C11H7NO3/c13-9-6-8(11(15)12-9)10(14)7-4-2-1-3-5-7/h1-6H,(H,12,13,15) |
| InChIKey | LQAWARCBBRNSQJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoylpyrrole-2,5-dione?
The IUPAC name of 3-benzoylpyrrole-2,5-dione (CID 154096189) is 3-benzoylpyrrole-2,5-dione.
What is the SMILES notation for 3-benzoylpyrrole-2,5-dione?
The canonical SMILES for 3-benzoylpyrrole-2,5-dione is O=C1C=C(C(=O)c2ccccc2)C(=O)N1.
What is the InChIKey of 3-benzoylpyrrole-2,5-dione?
The InChIKey is LQAWARCBBRNSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO3/c13-9-6-8(11(15)12-9)10(14)7-4-2-1-3-5-7/h1-6H,(H,12,13,15).
What are the key properties of 3-benzoylpyrrole-2,5-dione?
3-benzoylpyrrole-2,5-dione has a molecular weight of 201.18 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoylpyrrole-2,5-dione is sourced from PubChem (CID 154096189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).