C18H16N2O2 — CID 95989422
(2R,5S)-6-oxo-2,4-diphenyl-2,5-dihydro-1H-pyridine-5-carboxamide (PubChem CID 95989422) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2R,5S)-6-oxo-2,4-diphenyl-2,5-dihydro-1H-pyridine-5-carboxamide.
| Compound Name | (2R,5S)-6-oxo-2,4-diphenyl-2,5-dihydro-1H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 95989422 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (2R,5S)-6-oxo-2,4-diphenyl-2,5-dihydro-1H-pyridine-5-carboxamide |
| SMILES | NC(=O)[C@H]1C(=O)N[C@@H](c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2/c19-17(21)16-14(12-7-3-1-4-8-12)11-15(20-18(16)22)13-9-5-2-6-10-13/h1-11,15-16H,(H2,19,21)(H,20,22)/t15-,16+/m1/s1 |
| InChIKey | GENHYOVKLGWUIW-CVEARBPZSA-N |
| XLogP | 2.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|