C11H9N2O3- — CID 2426874
(4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-6-carboxylate (PubChem CID 2426874) has the molecular formula C11H9N2O3- and a molecular weight of 217.20 g/mol. Its IUPAC name is (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-6-carboxylate.
| Compound Name | (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2426874 |
| Molecular Formula | C11H9N2O3- |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | (4S)-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-6-carboxylate |
| SMILES | O=C1NC(C(=O)[O-])=C[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C11H10N2O3/c14-10(15)9-6-8(12-11(16)13-9)7-4-2-1-3-5-7/h1-6,8H,(H,14,15)(H2,12,13,16)/p-1/t8-/m0/s1 |
| InChIKey | JAGRUSXXRNCWLX-QMMMGPOBSA-M |
| XLogP | -0.33 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |