C16H14N2O2 — CID 45066445
4-(4-hydroxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 45066445) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 4-(4-hydroxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 45066445 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-(4-hydroxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | O=C1NC(c2ccccc2)=CC(c2ccc(O)cc2)N1 |
| InChI | InChI=1S/C16H14N2O2/c19-13-8-6-12(7-9-13)15-10-14(17-16(20)18-15)11-4-2-1-3-5-11/h1-10,15,19H,(H2,17,18,20) |
| InChIKey | ATFGBNGFVUMEOR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |