C18H14ClN3O — CID 25154762
6-(4-chlorophenyl)-4-(1H-indol-3-yl)-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 25154762) has the molecular formula C18H14ClN3O and a molecular weight of 323.78 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4-(1H-indol-3-yl)-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 6-(4-chlorophenyl)-4-(1H-indol-3-yl)-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 25154762 |
| Molecular Formula | C18H14ClN3O |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 6-(4-chlorophenyl)-4-(1H-indol-3-yl)-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | O=C1NC(c2ccc(Cl)cc2)=CC(c2c[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C18H14ClN3O/c19-12-7-5-11(6-8-12)16-9-17(22-18(23)21-16)14-10-20-15-4-2-1-3-13(14)15/h1-10,17,20H,(H2,21,22,23) |
| InChIKey | KWPSIKFOUHBFLG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |