C4H4NO5P — CID 123761683
(2,5-dioxopyrrol-3-yl)phosphonic acid (PubChem CID 123761683) has the molecular formula C4H4NO5P and a molecular weight of 177.05 g/mol. Its IUPAC name is (2,5-dioxopyrrol-3-yl)phosphonic acid.
| Compound Name | (2,5-dioxopyrrol-3-yl)phosphonic acid |
|---|---|
| PubChem CID | 123761683 |
| Molecular Formula | C4H4NO5P |
| Molecular Weight | 177.05 g/mol |
| Exact Mass | 176.98 |
| IUPAC Name | (2,5-dioxopyrrol-3-yl)phosphonic acid |
| SMILES | O=C1C=C(P(=O)(O)O)C(=O)N1 |
| InChI | InChI=1S/C4H4NO5P/c6-3-1-2(4(7)5-3)11(8,9)10/h1H,(H,5,6,7)(H2,8,9,10) |
| InChIKey | FNKCRNZQLZNVKF-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.05 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|