C11H11NO3 — CID 21418489
methanol;3-phenylpyrrole-2,5-dione (PubChem CID 21418489) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is methanol;3-phenylpyrrole-2,5-dione.
| Compound Name | methanol;3-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 21418489 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | methanol;3-phenylpyrrole-2,5-dione |
| SMILES | CO.O=C1C=C(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C10H7NO2.CH4O/c12-9-6-8(10(13)11-9)7-4-2-1-3-5-7;1-2/h1-6H,(H,11,12,13);2H,1H3 |
| InChIKey | PVDYDKQAIDJUSQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|