C8H9NO2 — CID 162192944
3-hydroxy-2,3,4,5-tetrahydroisoindol-1-one (PubChem CID 162192944) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3-hydroxy-2,3,4,5-tetrahydroisoindol-1-one.
| Compound Name | 3-hydroxy-2,3,4,5-tetrahydroisoindol-1-one |
|---|---|
| PubChem CID | 162192944 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3-hydroxy-2,3,4,5-tetrahydroisoindol-1-one |
| SMILES | O=C1NC(O)C2=C1C=CCC2 |
| InChI | InChI=1S/C8H9NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1,3,8,11H,2,4H2,(H,9,10) |
| InChIKey | ZQODLZACHKUWBD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |