About 6,7-dihydroindol-3-one
6,7-dihydroindol-3-one (PubChem CID 174864065) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 6,7-dihydroindol-3-one.
Molecular Properties
| Compound Name | 6,7-dihydroindol-3-one |
| PubChem CID | 174864065 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 6,7-dihydroindol-3-one |
| SMILES | O=C1C=NC2=C1C=CCC2 |
| InChI | InChI=1S/C8H7NO/c10-8-5-9-7-4-2-1-3-6(7)8/h1,3,5H,2,4H2 |
| InChIKey | WVQNVTNMGRSJSO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dihydroindol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydroindol-3-one?
The IUPAC name of 6,7-dihydroindol-3-one (CID 174864065) is 6,7-dihydroindol-3-one.
What is the SMILES notation for 6,7-dihydroindol-3-one?
The canonical SMILES for 6,7-dihydroindol-3-one is O=C1C=NC2=C1C=CCC2.
What is the InChIKey of 6,7-dihydroindol-3-one?
The InChIKey is WVQNVTNMGRSJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c10-8-5-9-7-4-2-1-3-6(7)8/h1,3,5H,2,4H2.
What are the key properties of 6,7-dihydroindol-3-one?
6,7-dihydroindol-3-one has a molecular weight of 133.15 g/mol, XLogP of 1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydroindol-3-one is sourced from PubChem (CID 174864065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).