About 6H-indole-3,5-dione
6H-indole-3,5-dione (PubChem CID 68606814) has the molecular formula C8H5NO2
and a molecular weight of 147.13 g/mol. Its IUPAC name is 6H-indole-3,5-dione.
Molecular Properties
| Compound Name | 6H-indole-3,5-dione |
| PubChem CID | 68606814 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 6H-indole-3,5-dione |
| SMILES | O=C1C=C2C(=O)C=NC2=CC1 |
| InChI | InChI=1S/C8H5NO2/c10-5-1-2-7-6(3-5)8(11)4-9-7/h2-4H,1H2 |
| InChIKey | GNFGCBNFTHWXHB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6H-indole-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-indole-3,5-dione?
The IUPAC name of 6H-indole-3,5-dione (CID 68606814) is 6H-indole-3,5-dione.
What is the SMILES notation for 6H-indole-3,5-dione?
The canonical SMILES for 6H-indole-3,5-dione is O=C1C=C2C(=O)C=NC2=CC1.
What is the InChIKey of 6H-indole-3,5-dione?
The InChIKey is GNFGCBNFTHWXHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2/c10-5-1-2-7-6(3-5)8(11)4-9-7/h2-4H,1H2.
What are the key properties of 6H-indole-3,5-dione?
6H-indole-3,5-dione has a molecular weight of 147.13 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-indole-3,5-dione is sourced from PubChem (CID 68606814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).