C8H9Br — CID 142476555
1-bromo-2-ethenylcyclohexa-1,3-diene (PubChem CID 142476555) has the molecular formula C8H9Br and a molecular weight of 185.06 g/mol. Its IUPAC name is 1-bromo-2-ethenylcyclohexa-1,3-diene.
| Compound Name | 1-bromo-2-ethenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142476555 |
| Molecular Formula | C8H9Br |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 1-bromo-2-ethenylcyclohexa-1,3-diene |
| SMILES | C=CC1=C(Br)CCC=C1 |
| InChI | InChI=1S/C8H9Br/c1-2-7-5-3-4-6-8(7)9/h2-3,5H,1,4,6H2 |
| InChIKey | CCVTVZBWZPYOOB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |