C8H10Br2 — CID 140580413
(1Z,3Z)-1,2-dibromocycloocta-1,3-diene (PubChem CID 140580413) has the molecular formula C8H10Br2 and a molecular weight of 265.98 g/mol. Its IUPAC name is (1Z,3Z)-1,2-dibromocycloocta-1,3-diene.
| Compound Name | (1Z,3Z)-1,2-dibromocycloocta-1,3-diene |
|---|---|
| PubChem CID | 140580413 |
| Molecular Formula | C8H10Br2 |
| Molecular Weight | 265.98 g/mol |
| Exact Mass | 263.91 |
| IUPAC Name | (1Z,3Z)-1,2-dibromocycloocta-1,3-diene |
| SMILES | BrC1=C(\Br)CCCC/C=C\1 |
| InChI | InChI=1S/C8H10Br2/c9-7-5-3-1-2-4-6-8(7)10/h3,5H,1-2,4,6H2/b5-3-,8-7- |
| InChIKey | SPXZDPXGPWMSHP-OVRZELKPSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.98 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |