C13H15Br — CID 161149242
1-bromo-2-cyclopenta-2,4-dien-1-ylcycloocta-1,5-diene (PubChem CID 161149242) has the molecular formula C13H15Br and a molecular weight of 251.17 g/mol. Its IUPAC name is 1-bromo-2-cyclopenta-2,4-dien-1-ylcycloocta-1,5-diene.
| Compound Name | 1-bromo-2-cyclopenta-2,4-dien-1-ylcycloocta-1,5-diene |
|---|---|
| PubChem CID | 161149242 |
| Molecular Formula | C13H15Br |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 1-bromo-2-cyclopenta-2,4-dien-1-ylcycloocta-1,5-diene |
| SMILES | BrC1=C(C2C=CC=C2)CCC=CCC1 |
| InChI | InChI=1S/C13H15Br/c14-13-10-4-2-1-3-9-12(13)11-7-5-6-8-11/h1-2,5-8,11H,3-4,9-10H2 |
| InChIKey | ZMUGAZZQNWJQJO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|