C11H12Ir — CID 158062216
1-cyclopenta-2,4-dien-1-ylcyclohexa-1,4-diene;iridium (PubChem CID 158062216) has the molecular formula C11H12Ir and a molecular weight of 336.43 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylcyclohexa-1,4-diene;iridium.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylcyclohexa-1,4-diene;iridium |
|---|---|
| PubChem CID | 158062216 |
| Molecular Formula | C11H12Ir |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylcyclohexa-1,4-diene;iridium |
| SMILES | C1=CC(C2=CCC=CC2)C=C1.[Ir] |
| InChI | InChI=1S/C11H12.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-11;/h1-2,4-5,7-9,11H,3,6H2; |
| InChIKey | FKUCCBSGQSVVNC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|