C12H16 — CID 123875821
1-cyclohex-3-en-1-ylcyclohexa-1,4-diene (PubChem CID 123875821) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-ylcyclohexa-1,4-diene.
| Compound Name | 1-cyclohex-3-en-1-ylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 123875821 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-cyclohex-3-en-1-ylcyclohexa-1,4-diene |
| SMILES | C1=CCC(C2CC=CCC2)=CC1 |
| InChI | InChI=1S/C12H16/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-3,5,8,12H,4,6-7,9-10H2 |
| InChIKey | LXVUAIGCJPXNFZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|