C18H21N — CID 142614805
3-cyclohexa-1,5-dien-1-yl-5-cyclohex-3-en-1-ylaniline (PubChem CID 142614805) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-5-cyclohex-3-en-1-ylaniline.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-5-cyclohex-3-en-1-ylaniline |
|---|---|
| PubChem CID | 142614805 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-5-cyclohex-3-en-1-ylaniline |
| SMILES | Nc1cc(C2=CCCC=C2)cc(C2CC=CCC2)c1 |
| InChI | InChI=1S/C18H21N/c19-18-12-16(14-7-3-1-4-8-14)11-17(13-18)15-9-5-2-6-10-15/h1,3,5,9-14H,2,4,6-8,19H2 |
| InChIKey | RMZMMRNTVFGWGY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|