C31H27N — CID 135143803
2-(3-cyclohepta-2,5-dien-1-yl-5-cyclohexa-1,5-dien-1-ylphenyl)-9H-carbazole (PubChem CID 135143803) has the molecular formula C31H27N and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-(3-cyclohepta-2,5-dien-1-yl-5-cyclohexa-1,5-dien-1-ylphenyl)-9H-carbazole.
| Compound Name | 2-(3-cyclohepta-2,5-dien-1-yl-5-cyclohexa-1,5-dien-1-ylphenyl)-9H-carbazole |
|---|---|
| PubChem CID | 135143803 |
| Molecular Formula | C31H27N |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-(3-cyclohepta-2,5-dien-1-yl-5-cyclohexa-1,5-dien-1-ylphenyl)-9H-carbazole |
| SMILES | C1=CCC(c2cc(C3=CCCC=C3)cc(-c3ccc4c(c3)[nH]c3ccccc34)c2)C=CC1 |
| InChI | InChI=1S/C31H27N/c1-2-5-11-22(10-4-1)25-18-26(23-12-6-3-7-13-23)20-27(19-25)24-16-17-29-28-14-8-9-15-30(28)32-31(29)21-24/h1,4-6,8-9,11-22,32H,2-3,7,10H2 |
| InChIKey | CRUNYBJKTUPLQV-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|