C19H17N — CID 167223460
2-(4-methylcyclohexa-1,5-dien-1-yl)-9H-carbazole (PubChem CID 167223460) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(4-methylcyclohexa-1,5-dien-1-yl)-9H-carbazole.
| Compound Name | 2-(4-methylcyclohexa-1,5-dien-1-yl)-9H-carbazole |
|---|---|
| PubChem CID | 167223460 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-(4-methylcyclohexa-1,5-dien-1-yl)-9H-carbazole |
| SMILES | CC1C=CC(c2ccc3c(c2)[nH]c2ccccc23)=CC1 |
| InChI | InChI=1S/C19H17N/c1-13-6-8-14(9-7-13)15-10-11-17-16-4-2-3-5-18(16)20-19(17)12-15/h2-6,8-13,20H,7H2,1H3 |
| InChIKey | YXLMPUUKLOBONB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |