C54H47N — CID 144542330
(E)-[(10Z)-2-(3-cyclohexa-1,5-dien-1-yl-5-cyclohex-3-en-1-ylphenyl)-7-(3,5-diphenylphenyl)-10-propylidenephenanthren-9-ylidene]methanamine (PubChem CID 144542330) has the molecular formula C54H47N and a molecular weight of 709.98 g/mol. Its IUPAC name is (E)-[(10Z)-2-(3-cyclohexa-1,5-dien-1-yl-5-cyclohex-3-en-1-ylphenyl)-7-(3,5-diphenylphenyl)-10-propylidenephenanthren-9-ylidene]methanamine.
| Compound Name | (E)-[(10Z)-2-(3-cyclohexa-1,5-dien-1-yl-5-cyclohex-3-en-1-ylphenyl)-7-(3,5-diphenylphenyl)-10-propylidenephenanthren-9-ylidene]methanamine |
|---|---|
| PubChem CID | 144542330 |
| Molecular Formula | C54H47N |
| Molecular Weight | 709.98 g/mol |
| Exact Mass | 709.37 |
| IUPAC Name | (E)-[(10Z)-2-(3-cyclohexa-1,5-dien-1-yl-5-cyclohex-3-en-1-ylphenyl)-7-(3,5-diphenylphenyl)-10-propylidenephenanthren-9-ylidene]methanamine |
| SMILES | CC/C=c1\c(=C/N)c2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)ccc2c2ccc(-c3cc(C4=CCCC=C4)cc(C4CC=CCC4)c3)cc12 |
| InChI | InChI=1S/C54H47N/c1-2-15-49-52-34-41(47-30-43(37-16-7-3-8-17-37)28-44(31-47)38-18-9-4-10-19-38)24-26-50(52)51-27-25-42(35-53(51)54(49)36-55)48-32-45(39-20-11-5-12-21-39)29-46(33-48)40-22-13-6-14-23-40/h3,5-7,9,11-15,18-37H,2,4,8,10,16-17,55H2,1H3/b49-15-,54-36+ |
| InChIKey | MNQMIJSPDFCRLT-TXJJFPMMSA-N |
| XLogP | 13.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.98 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|