C15H20O3 — CID 89431586
1-[(1S)-cyclohex-3-en-1-yl]-2,3,4-trimethoxybenzene (PubChem CID 89431586) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-[(1S)-cyclohex-3-en-1-yl]-2,3,4-trimethoxybenzene.
| Compound Name | 1-[(1S)-cyclohex-3-en-1-yl]-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 89431586 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-[(1S)-cyclohex-3-en-1-yl]-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc([C@@H]2CC=CCC2)c(OC)c1OC |
| InChI | InChI=1S/C15H20O3/c1-16-13-10-9-12(11-7-5-4-6-8-11)14(17-2)15(13)18-3/h4-5,9-11H,6-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | AEWIJVBJSYPPDR-LLVKDONJSA-N |
| XLogP | 3.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|