C16H16 — CID 154168790
tricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10-hexaene (PubChem CID 154168790) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is tricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | tricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 154168790 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | tricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10-hexaene |
| SMILES | C1=Cc2ccccc2C=CC2=C1CCCC2 |
| InChI | InChI=1S/C16H16/c1-2-6-14-11-12-16-8-4-3-7-15(16)10-9-13(14)5-1/h1-2,5-6,9-12H,3-4,7-8H2 |
| InChIKey | HTHSXEALAQCWSH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |