C8H10O2 — CID 10558683
(2R,3S)-bicyclo[4.2.0]octa-1(6),4-diene-2,3-diol (PubChem CID 10558683) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (2R,3S)-bicyclo[4.2.0]octa-1(6),4-diene-2,3-diol.
| Compound Name | (2R,3S)-bicyclo[4.2.0]octa-1(6),4-diene-2,3-diol |
|---|---|
| PubChem CID | 10558683 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (2R,3S)-bicyclo[4.2.0]octa-1(6),4-diene-2,3-diol |
| SMILES | O[C@@H]1C2=C(C=C[C@@H]1O)CC2 |
| InChI | InChI=1S/C8H10O2/c9-7-4-2-5-1-3-6(5)8(7)10/h2,4,7-10H,1,3H2/t7-,8+/m0/s1 |
| InChIKey | ATMZRMCFVFBJKP-JGVFFNPUSA-N |
| XLogP | 0.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |