C9H13BrO2 — CID 101418300
(1S,2R)-4-bromo-3-propylcyclohexa-3,5-diene-1,2-diol (PubChem CID 101418300) has the molecular formula C9H13BrO2 and a molecular weight of 233.10 g/mol. Its IUPAC name is (1S,2R)-4-bromo-3-propylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-4-bromo-3-propylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 101418300 |
| Molecular Formula | C9H13BrO2 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (1S,2R)-4-bromo-3-propylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CCCC1=C(Br)C=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H13BrO2/c1-2-3-6-7(10)4-5-8(11)9(6)12/h4-5,8-9,11-12H,2-3H2,1H3/t8-,9+/m0/s1 |
| InChIKey | MIVYRNBKVMLEQG-DTWKUNHWSA-N |
| XLogP | 1.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |