C9H12Br2O2 — CID 161041297
2,6-dibromo-4-propylcyclohexa-2,4-diene-1,1-diol (PubChem CID 161041297) has the molecular formula C9H12Br2O2 and a molecular weight of 312.00 g/mol. Its IUPAC name is 2,6-dibromo-4-propylcyclohexa-2,4-diene-1,1-diol.
| Compound Name | 2,6-dibromo-4-propylcyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 161041297 |
| Molecular Formula | C9H12Br2O2 |
| Molecular Weight | 312.00 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 2,6-dibromo-4-propylcyclohexa-2,4-diene-1,1-diol |
| SMILES | CCCC1=CC(Br)C(O)(O)C(Br)=C1 |
| InChI | InChI=1S/C9H12Br2O2/c1-2-3-6-4-7(10)9(12,13)8(11)5-6/h4-5,7,12-13H,2-3H2,1H3 |
| InChIKey | UAXMSTSCXFECEK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.00 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|