C18H22 — CID 142497404
(3-butyl-5-prop-1-en-2-ylcyclopenta-1,3-dien-1-yl)benzene (PubChem CID 142497404) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is (3-butyl-5-prop-1-en-2-ylcyclopenta-1,3-dien-1-yl)benzene.
| Compound Name | (3-butyl-5-prop-1-en-2-ylcyclopenta-1,3-dien-1-yl)benzene |
|---|---|
| PubChem CID | 142497404 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (3-butyl-5-prop-1-en-2-ylcyclopenta-1,3-dien-1-yl)benzene |
| SMILES | C=C(C)C1C=C(CCCC)C=C1c1ccccc1 |
| InChI | InChI=1S/C18H22/c1-4-5-9-15-12-17(14(2)3)18(13-15)16-10-7-6-8-11-16/h6-8,10-13,17H,2,4-5,9H2,1,3H3 |
| InChIKey | HDDUUDPEBHPFFT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|